C19H21N3O5 — CID 17138340
methyl (E)-2-cyano-3-[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazin-1-yl]prop-2-enoate (PubChem CID 17138340) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazin-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazin-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 17138340 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl (E)-2-cyano-3-[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazin-1-yl]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/N1CCNC(=O)C1CC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O5/c1-26-19(25)15(12-20)13-22-9-8-21-18(24)16(22)11-17(23)27-10-7-14-5-3-2-4-6-14/h2-6,13,16H,7-11H2,1H3,(H,21,24)/b15-13+ |
| InChIKey | TWSQAGRSPFSBIR-FYWRMAATSA-N |
| XLogP | 0.54 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|