C22H35N3O5 — CID 17155004
ethyl (E)-2-cyano-3-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]prop-2-enoate (PubChem CID 17155004) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 17155004 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]prop-2-enoate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1/C=C(\C#N)C(=O)OCC |
| InChI | InChI=1S/C22H35N3O5/c1-3-5-6-7-8-9-10-11-14-30-20(26)15-19-21(27)24-12-13-25(19)17-18(16-23)22(28)29-4-2/h17,19H,3-15H2,1-2H3,(H,24,27)/b18-17+ |
| InChIKey | OOTYRCVJXHOZGG-ISLYRVAYSA-N |
| XLogP | 2.83 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|