C17H24N2O7 — CID 17138469
butyl 2-[1-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17138469) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is butyl 2-[1-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17138469 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | butyl 2-[1-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H24N2O7/c1-4-5-8-24-13(20)9-12-14(21)18-6-7-19(12)10-11-15(22)25-17(2,3)26-16(11)23/h10,12H,4-9H2,1-3H3,(H,18,21) |
| InChIKey | YOZBHZFRPQRMTG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|