C23H31NO5 — CID 171387777
N-methyl-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxy-N-(oxan-4-ylmethyl)propanamide (PubChem CID 171387777) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is N-methyl-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxy-N-(oxan-4-ylmethyl)propanamide.
| Compound Name | N-methyl-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxy-N-(oxan-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 171387777 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-methyl-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxy-N-(oxan-4-ylmethyl)propanamide |
| SMILES | CCCc1cc(=O)oc2c(C)c(OC(C)C(=O)N(C)CC3CCOCC3)ccc12 |
| InChI | InChI=1S/C23H31NO5/c1-5-6-18-13-21(25)29-22-15(2)20(8-7-19(18)22)28-16(3)23(26)24(4)14-17-9-11-27-12-10-17/h7-8,13,16-17H,5-6,9-12,14H2,1-4H3 |
| InChIKey | DOHIBSZWDHDIHX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|