C18H20N4O4 — CID 171388957
2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(2-ethyltriazol-4-yl)propanamide (PubChem CID 171388957) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(2-ethyltriazol-4-yl)propanamide.
| Compound Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(2-ethyltriazol-4-yl)propanamide |
|---|---|
| PubChem CID | 171388957 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(2-ethyltriazol-4-yl)propanamide |
| SMILES | CCn1ncc(NC(=O)C(C)Oc2ccc3c(C)c(C)c(=O)oc3c2)n1 |
| InChI | InChI=1S/C18H20N4O4/c1-5-22-19-9-16(21-22)20-17(23)12(4)25-13-6-7-14-10(2)11(3)18(24)26-15(14)8-13/h6-9,12H,5H2,1-4H3,(H,20,21,23) |
| InChIKey | BOYOICMPSSMZAY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|