C27H30F4N4O3 — CID 171392659
7-(2-fluorophenyl)-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 171392659) has the molecular formula C27H30F4N4O3 and a molecular weight of 534.55 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-(2-fluorophenyl)-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 171392659 |
| Molecular Formula | C27H30F4N4O3 |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 7-(2-fluorophenyl)-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | CN1C(=O)C(=O)N(C2CCN(Cc3ccc(OC(F)(F)F)cc3)CC2)C2NCC(c3ccccc3F)CC21 |
| InChI | InChI=1S/C27H30F4N4O3/c1-33-23-14-18(21-4-2-3-5-22(21)28)15-32-24(23)35(26(37)25(33)36)19-10-12-34(13-11-19)16-17-6-8-20(9-7-17)38-27(29,30)31/h2-9,18-19,23-24,32H,10-16H2,1H3 |
| InChIKey | YTUVUFXFZNOXIX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|