C19H19ClN4OS — CID 171404382
N-(6-chloro-3-pyridinyl)-6-[(cyclopropylmethyl-methyl-oxo-λ6-sulfanylidene)amino]isoquinolin-1-amine (PubChem CID 171404382) has the molecular formula C19H19ClN4OS and a molecular weight of 386.91 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-6-[(cyclopropylmethyl-methyl-oxo-λ6-sulfanylidene)amino]isoquinolin-1-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-6-[(cyclopropylmethyl-methyl-oxo-λ6-sulfanylidene)amino]isoquinolin-1-amine |
|---|---|
| PubChem CID | 171404382 |
| Molecular Formula | C19H19ClN4OS |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-6-[(cyclopropylmethyl-methyl-oxo-λ6-sulfanylidene)amino]isoquinolin-1-amine |
| SMILES | CS(=O)(CC1CC1)=Nc1ccc2c(Nc3ccc(Cl)nc3)nccc2c1 |
| InChI | InChI=1S/C19H19ClN4OS/c1-26(25,12-13-2-3-13)24-15-4-6-17-14(10-15)8-9-21-19(17)23-16-5-7-18(20)22-11-16/h4-11,13H,2-3,12H2,1H3,(H,21,23) |
| InChIKey | CLIWIUHWECPQNG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|