C51H42 — CID 171415316
7-(5,7-diethylnaphthalen-2-yl)-9-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-propan-2-ylphenanthrene (PubChem CID 171415316) has the molecular formula C51H42 and a molecular weight of 659.93 g/mol. Its IUPAC name is 7-(5,7-diethylnaphthalen-2-yl)-9-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-propan-2-ylphenanthrene.
| Compound Name | 7-(5,7-diethylnaphthalen-2-yl)-9-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-propan-2-ylphenanthrene |
|---|---|
| PubChem CID | 171415316 |
| Molecular Formula | C51H42 |
| Molecular Weight | 659.93 g/mol |
| Exact Mass | 659.36 |
| IUPAC Name | 7-(5,7-diethylnaphthalen-2-yl)-9-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-propan-2-ylphenanthrene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cc4cc(C(C)C)ccc4c4ccc(-c5ccc6c(CC)cc(CC)cc6c5)cc34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C51H42/c1-5-33-26-34(6-2)41-23-21-37(29-39(41)27-33)38-22-25-43-42-24-20-36(32(3)4)28-40(42)31-49(48(43)30-38)51-46-18-12-10-16-44(46)50(35-14-8-7-9-15-35)45-17-11-13-19-47(45)51/h7-32H,5-6H2,1-4H3/i7D,8D,9D,14D,15D |
| InChIKey | QWZLQASLGSEZHW-CFPNEJFESA-N |
| XLogP | 14.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.93 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|