C53H33N3 — CID 88868940
2-[3,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-4-chrysen-6-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 88868940) has the molecular formula C53H33N3 and a molecular weight of 726.96 g/mol. Its IUPAC name is 2-[3,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-4-chrysen-6-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-[3,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-4-chrysen-6-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 88868940 |
| Molecular Formula | C53H33N3 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.36 |
| IUPAC Name | 2-[3,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-4-chrysen-6-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4nc(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])nc(-c5cc6c7ccccc7ccc6c6ccccc56)n4)c4ccccc4c(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H33N3/c1-4-16-34(17-5-1)38-29-31-45-47(32-38)49(36-19-6-2-7-20-36)43-26-14-15-27-44(43)50(45)53-55-51(37-21-8-3-9-22-37)54-52(56-53)48-33-46-39-23-11-10-18-35(39)28-30-42(46)40-24-12-13-25-41(40)48/h1-33H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,16D,17D,19D,20D,21D,22D |
| InChIKey | PGGBCEYGHAOXTC-JWTBQTMHSA-N |
| XLogP | 13.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|