About 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol
2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol (PubChem CID 171422420) has the molecular formula C20H14O5
and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol.
Molecular Properties
| Compound Name | 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol |
| PubChem CID | 171422420 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol |
| SMILES | Oc1cccc2c(O)c(Oc3ccc4c(O)cccc4c3O)ccc12 |
| InChI | InChI=1S/C20H14O5/c21-15-5-1-3-13-11(15)7-9-17(19(13)23)25-18-10-8-12-14(20(18)24)4-2-6-16(12)22/h1-10,21-24H |
| InChIKey | NPPVYAUOCJRPGZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol?
The IUPAC name of 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol (CID 171422420) is 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol.
What is the SMILES notation for 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol?
The canonical SMILES for 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol is Oc1cccc2c(O)c(Oc3ccc4c(O)cccc4c3O)ccc12.
What is the InChIKey of 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol?
The InChIKey is NPPVYAUOCJRPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O5/c21-15-5-1-3-13-11(15)7-9-17(19(13)23)25-18-10-8-12-14(20(18)24)4-2-6-16(12)22/h1-10,21-24H.
What are the key properties of 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol?
2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol has a molecular weight of 334.33 g/mol, XLogP of 4.61, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dihydroxynaphthalen-2-yl)oxynaphthalene-1,5-diol is sourced from PubChem (CID 171422420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).