C13H18ClN3O3S — CID 171430440
2-[(6-chloro-3-morpholin-4-yl-2-pyridinyl)methyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 171430440) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-[(6-chloro-3-morpholin-4-yl-2-pyridinyl)methyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[(6-chloro-3-morpholin-4-yl-2-pyridinyl)methyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 171430440 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-[(6-chloro-3-morpholin-4-yl-2-pyridinyl)methyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1Cc1nc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C13H18ClN3O3S/c14-13-3-2-12(16-5-7-20-8-6-16)11(15-13)10-17-4-1-9-21(17,18)19/h2-3H,1,4-10H2 |
| InChIKey | JOGABVBDAUKERT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|