C42H25N7S2Si — CID 171449997
2-[4-(1,3-benzothiazol-2-yl)-6-[3-(6-phenylbenzimidazolo[1,2-a][1,3]benzazasilol-6-yl)phenyl]-1,3,5-triazin-2-yl]-1,3-benzothiazole (PubChem CID 171449997) has the molecular formula C42H25N7S2Si and a molecular weight of 719.93 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-6-[3-(6-phenylbenzimidazolo[1,2-a][1,3]benzazasilol-6-yl)phenyl]-1,3,5-triazin-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)-6-[3-(6-phenylbenzimidazolo[1,2-a][1,3]benzazasilol-6-yl)phenyl]-1,3,5-triazin-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 171449997 |
| Molecular Formula | C42H25N7S2Si |
| Molecular Weight | 719.93 g/mol |
| Exact Mass | 719.14 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)-6-[3-(6-phenylbenzimidazolo[1,2-a][1,3]benzazasilol-6-yl)phenyl]-1,3,5-triazin-2-yl]-1,3-benzothiazole |
| SMILES | c1ccc([Si]2(c3cccc(-c4nc(-c5nc6ccccc6s5)nc(-c5nc6ccccc6s5)n4)c3)c3ccccc3-n3c2nc2ccccc23)cc1 |
| InChI | InChI=1S/C42H25N7S2Si/c1-2-14-27(15-3-1)52(36-24-11-8-21-33(36)49-32-20-7-4-17-29(32)45-42(49)52)28-16-12-13-26(25-28)37-46-38(40-43-30-18-5-9-22-34(30)50-40)48-39(47-37)41-44-31-19-6-10-23-35(31)51-41/h1-25H |
| InChIKey | SOVNQCVIWFZBFC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.93 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|