C40H27N5Si — CID 171450028
10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-diphenylbenzimidazolo[1,2-a][1,3]benzazasilole (PubChem CID 171450028) has the molecular formula C40H27N5Si and a molecular weight of 605.78 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-diphenylbenzimidazolo[1,2-a][1,3]benzazasilole.
| Compound Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-diphenylbenzimidazolo[1,2-a][1,3]benzazasilole |
|---|---|
| PubChem CID | 171450028 |
| Molecular Formula | C40H27N5Si |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-diphenylbenzimidazolo[1,2-a][1,3]benzazasilole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3-n3c(nc5ccccc53)[Si]4(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C40H27N5Si/c1-5-16-28(17-6-1)37-42-38(29-18-7-2-8-19-29)44-39(43-37)32-24-15-27-35-36(32)45-34-26-14-13-25-33(34)41-40(45)46(35,30-20-9-3-10-21-30)31-22-11-4-12-23-31/h1-27H |
| InChIKey | LAYGSPQCAUCBIA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|