C19H22BFN2O4S — CID 171454093
tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-isocyano-1-benzothiophen-2-yl]carbamate (PubChem CID 171454093) has the molecular formula C19H22BFN2O4S and a molecular weight of 404.27 g/mol. Its IUPAC name is tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-isocyano-1-benzothiophen-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-isocyano-1-benzothiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 171454093 |
| Molecular Formula | C19H22BFN2O4S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-fluoro-3-isocyano-1-benzothiophen-2-yl]carbamate |
| SMILES | [C-]#[N+]c1c(NC(=O)OC(C)(C)C)sc2c(F)ccc(B3OCC(C)(C)CO3)c12 |
| InChI | InChI=1S/C19H22BFN2O4S/c1-18(2,3)27-17(24)23-16-14(22-6)13-11(7-8-12(21)15(13)28-16)20-25-9-19(4,5)10-26-20/h7-8H,9-10H2,1-5H3,(H,23,24) |
| InChIKey | VCIIQOZLDXETOC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|