C20H20N4O5 — CID 171460045
(2S)-3-[3-[5-[(2S)-2-cyano-2-formamidoethyl]-2-hydroxyphenyl]-4-hydroxyphenyl]-2-formamidopropanamide (PubChem CID 171460045) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is (2S)-3-[3-[5-[(2S)-2-cyano-2-formamidoethyl]-2-hydroxyphenyl]-4-hydroxyphenyl]-2-formamidopropanamide.
| Compound Name | (2S)-3-[3-[5-[(2S)-2-cyano-2-formamidoethyl]-2-hydroxyphenyl]-4-hydroxyphenyl]-2-formamidopropanamide |
|---|---|
| PubChem CID | 171460045 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (2S)-3-[3-[5-[(2S)-2-cyano-2-formamidoethyl]-2-hydroxyphenyl]-4-hydroxyphenyl]-2-formamidopropanamide |
| SMILES | N#C[C@H](Cc1ccc(O)c(-c2cc(C[C@H](NC=O)C(N)=O)ccc2O)c1)NC=O |
| InChI | InChI=1S/C20H20N4O5/c21-9-14(23-10-25)5-12-1-3-18(27)15(6-12)16-7-13(2-4-19(16)28)8-17(20(22)29)24-11-26/h1-4,6-7,10-11,14,17,27-28H,5,8H2,(H2,22,29)(H,23,25)(H,24,26)/t14-,17-/m0/s1 |
| InChIKey | VTSQYNNDUMUQDT-YOEHRIQHSA-N |
| XLogP | 0.09 |
| TPSA | 165.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|