C19H13ClF5N3O3S2 — CID 171472664
5-(5-chlorothiophen-2-yl)-3-ethylsulfonyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide (PubChem CID 171472664) has the molecular formula C19H13ClF5N3O3S2 and a molecular weight of 525.91 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)-3-ethylsulfonyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 5-(5-chlorothiophen-2-yl)-3-ethylsulfonyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171472664 |
| Molecular Formula | C19H13ClF5N3O3S2 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)-3-ethylsulfonyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide |
| SMILES | CCS(=O)(=O)c1cc(-c2ccc(Cl)s2)cnc1C(=O)Nc1ccc(C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H13ClF5N3O3S2/c1-2-33(30,31)13-7-10(12-4-5-14(20)32-12)8-27-16(13)17(29)28-15-6-3-11(9-26-15)18(21,22)19(23,24)25/h3-9H,2H2,1H3,(H,26,28,29) |
| InChIKey | WVCVRSGINCYMQL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|