C14H11Cl3N2O3S — CID 75468067
2-chloro-N-(4,5-dichloro-2-pyridinyl)-5-ethylsulfonylbenzamide (PubChem CID 75468067) has the molecular formula C14H11Cl3N2O3S and a molecular weight of 393.68 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dichloro-2-pyridinyl)-5-ethylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(4,5-dichloro-2-pyridinyl)-5-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 75468067 |
| Molecular Formula | C14H11Cl3N2O3S |
| Molecular Weight | 393.68 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2-chloro-N-(4,5-dichloro-2-pyridinyl)-5-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2cc(Cl)c(Cl)cn2)c1 |
| InChI | InChI=1S/C14H11Cl3N2O3S/c1-2-23(21,22)8-3-4-10(15)9(5-8)14(20)19-13-6-11(16)12(17)7-18-13/h3-7H,2H2,1H3,(H,18,19,20) |
| InChIKey | KNYWGYDIOIIGSR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.68 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |