C26H35N5O3 — CID 171475127
tert-butyl (6R,11R)-6,11-dimethyl-3-oxo-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxylate (PubChem CID 171475127) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is tert-butyl (6R,11R)-6,11-dimethyl-3-oxo-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxylate.
| Compound Name | tert-butyl (6R,11R)-6,11-dimethyl-3-oxo-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxylate |
|---|---|
| PubChem CID | 171475127 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl (6R,11R)-6,11-dimethyl-3-oxo-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-12-carboxylate |
| SMILES | C=C(C)c1ccc(C(C)N2C[C@@H](C)n3nc4c(c3C2=O)CN(C(=O)OC(C)(C)C)[C@H](C)C4)cn1 |
| InChI | InChI=1S/C26H35N5O3/c1-15(2)21-10-9-19(12-27-21)18(5)30-13-17(4)31-23(24(30)32)20-14-29(16(3)11-22(20)28-31)25(33)34-26(6,7)8/h9-10,12,16-18H,1,11,13-14H2,2-8H3/t16-,17-,18?/m1/s1 |
| InChIKey | ZGSWZCLQHMRSQS-OWZOALSMSA-N |
| XLogP | 4.77 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |