C38H39ClN6O6 — CID 171481260
3-[7-[6-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171481260) has the molecular formula C38H39ClN6O6 and a molecular weight of 711.22 g/mol. Its IUPAC name is 3-[7-[6-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[6-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171481260 |
| Molecular Formula | C38H39ClN6O6 |
| Molecular Weight | 711.22 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | 3-[7-[6-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCc1c[nH]c2ncc(-c3cccc(N4CCN(C(=O)CCCCCOc5cccc6c5CN(C5CCC(=O)NC5=O)C6=O)CC4=O)c3)c(Cl)c12 |
| InChI | InChI=1S/C38H39ClN6O6/c1-2-23-19-40-36-34(23)35(39)27(20-41-36)24-8-6-9-25(18-24)44-16-15-43(22-33(44)48)32(47)12-4-3-5-17-51-30-11-7-10-26-28(30)21-45(38(26)50)29-13-14-31(46)42-37(29)49/h6-11,18-20,29H,2-5,12-17,21-22H2,1H3,(H,40,41)(H,42,46,49) |
| InChIKey | PAFDVFIKEHRBAB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|