C40H44ClN7O5 — CID 171481216
3-[7-[[8-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-8-oxooctyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171481216) has the molecular formula C40H44ClN7O5 and a molecular weight of 738.29 g/mol. Its IUPAC name is 3-[7-[[8-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-8-oxooctyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[8-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-8-oxooctyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171481216 |
| Molecular Formula | C40H44ClN7O5 |
| Molecular Weight | 738.29 g/mol |
| Exact Mass | 737.31 |
| IUPAC Name | 3-[7-[[8-[4-[3-(4-chloro-3-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-3-oxopiperazin-1-yl]-8-oxooctyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCc1c[nH]c2ncc(-c3cccc(N4CCN(C(=O)CCCCCCCNc5cccc6c5CN(C5CCC(=O)NC5=O)C6=O)CC4=O)c3)c(Cl)c12 |
| InChI | InChI=1S/C40H44ClN7O5/c1-2-25-21-43-38-36(25)37(41)29(22-44-38)26-10-8-11-27(20-26)47-19-18-46(24-35(47)51)34(50)14-6-4-3-5-7-17-42-31-13-9-12-28-30(31)23-48(40(28)53)32-15-16-33(49)45-39(32)52/h8-13,20-22,32,42H,2-7,14-19,23-24H2,1H3,(H,43,44)(H,45,49,52) |
| InChIKey | RLEGVDKYEKMJCY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 147.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|