C32H41FN6O2 — CID 171483785
methyl (3S)-3-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4-[5-fluoro-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-2-yl]butanoate (PubChem CID 171483785) has the molecular formula C32H41FN6O2 and a molecular weight of 560.72 g/mol. Its IUPAC name is methyl (3S)-3-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4-[5-fluoro-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-2-yl]butanoate.
| Compound Name | methyl (3S)-3-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4-[5-fluoro-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-2-yl]butanoate |
|---|---|
| PubChem CID | 171483785 |
| Molecular Formula | C32H41FN6O2 |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | methyl (3S)-3-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4-[5-fluoro-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-2-yl]butanoate |
| SMILES | COC(=O)C[C@H](CN1CC2(CCN(Cc3ccc4c(n3)NCCC4)CC2F)C1)c1cccc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C32H41FN6O2/c1-22-14-23(2)39(36-22)28-8-4-6-25(15-28)26(16-30(40)41-3)17-38-20-32(21-38)11-13-37(19-29(32)33)18-27-10-9-24-7-5-12-34-31(24)35-27/h4,6,8-10,14-15,26,29H,5,7,11-13,16-21H2,1-3H3,(H,34,35)/t26-,29?/m1/s1 |
| InChIKey | CSGOMBOVUPIKLN-QZWVJJBASA-N |
| XLogP | 4.43 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |