C16H26BrNO3 — CID 171497850
tert-butyl 3-[(3Z)-4-bromohexa-1,3-dien-3-yl]-3-hydroxypiperidine-1-carboxylate (PubChem CID 171497850) has the molecular formula C16H26BrNO3 and a molecular weight of 360.29 g/mol. Its IUPAC name is tert-butyl 3-[(3Z)-4-bromohexa-1,3-dien-3-yl]-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3Z)-4-bromohexa-1,3-dien-3-yl]-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171497850 |
| Molecular Formula | C16H26BrNO3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | tert-butyl 3-[(3Z)-4-bromohexa-1,3-dien-3-yl]-3-hydroxypiperidine-1-carboxylate |
| SMILES | C=C/C(=C(/Br)CC)C1(O)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26BrNO3/c1-6-12(13(17)7-2)16(20)9-8-10-18(11-16)14(19)21-15(3,4)5/h6,20H,1,7-11H2,2-5H3/b13-12- |
| InChIKey | JPFXOSOQLLMLGA-SEYXRHQNSA-N |
| XLogP | 3.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|