C19H21ClN4O3 — CID 171499263
N-[2-(3-chlorophenyl)pyrimidin-4-yl]acetamide;1-morpholin-4-ylprop-2-en-1-one (PubChem CID 171499263) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)pyrimidin-4-yl]acetamide;1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | N-[2-(3-chlorophenyl)pyrimidin-4-yl]acetamide;1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 171499263 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[2-(3-chlorophenyl)pyrimidin-4-yl]acetamide;1-morpholin-4-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOCC1.CC(=O)Nc1ccnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H10ClN3O.C7H11NO2/c1-8(17)15-11-5-6-14-12(16-11)9-3-2-4-10(13)7-9;1-2-7(9)8-3-5-10-6-4-8/h2-7H,1H3,(H,14,15,16,17);2H,1,3-6H2 |
| InChIKey | BNCFENLTRZCMED-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|