C17H23ClN4O2 — CID 171499135
(Z)-N'-(1-aminoethenyl)-1-(3-chlorophenyl)ethene-1,2-diamine;1-morpholin-4-ylprop-2-en-1-one (PubChem CID 171499135) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is (Z)-N'-(1-aminoethenyl)-1-(3-chlorophenyl)ethene-1,2-diamine;1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (Z)-N'-(1-aminoethenyl)-1-(3-chlorophenyl)ethene-1,2-diamine;1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 171499135 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (Z)-N'-(1-aminoethenyl)-1-(3-chlorophenyl)ethene-1,2-diamine;1-morpholin-4-ylprop-2-en-1-one |
| SMILES | C=C(N)N/C=C(\N)c1cccc(Cl)c1.C=CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H12ClN3.C7H11NO2/c1-7(12)14-6-10(13)8-3-2-4-9(11)5-8;1-2-7(9)8-3-5-10-6-4-8/h2-6,14H,1,12-13H2;2H,1,3-6H2/b10-6-; |
| InChIKey | WVOBPNMHPMBXMD-OTUCAILMSA-N |
| XLogP | 1.65 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|