C17H23ClN4O2 — CID 171499365
(3E)-3-(3-chlorophenyl)buta-1,3-diene-1,1,4-triamine;1-morpholin-4-ylprop-2-en-1-one (PubChem CID 171499365) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is (3E)-3-(3-chlorophenyl)buta-1,3-diene-1,1,4-triamine;1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (3E)-3-(3-chlorophenyl)buta-1,3-diene-1,1,4-triamine;1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 171499365 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3E)-3-(3-chlorophenyl)buta-1,3-diene-1,1,4-triamine;1-morpholin-4-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOCC1.N/C=C(\C=C(N)N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H12ClN3.C7H11NO2/c11-9-3-1-2-7(4-9)8(6-12)5-10(13)14;1-2-7(9)8-3-5-10-6-4-8/h1-6H,12-14H2;2H,1,3-6H2/b8-6+; |
| InChIKey | WATJXVRTVYEVCW-WVLIHFOGSA-N |
| XLogP | 1.43 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|