C22H37N5O4 — CID 171502663
2-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]ethanol;prop-1-en-2-amine;4-N,4-N,2-trimethylbenzene-1,4-diamine (PubChem CID 171502663) has the molecular formula C22H37N5O4 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]ethanol;prop-1-en-2-amine;4-N,4-N,2-trimethylbenzene-1,4-diamine.
| Compound Name | 2-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]ethanol;prop-1-en-2-amine;4-N,4-N,2-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 171502663 |
| Molecular Formula | C22H37N5O4 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 2-[2,5-diamino-4-(2-hydroxyethoxy)phenoxy]ethanol;prop-1-en-2-amine;4-N,4-N,2-trimethylbenzene-1,4-diamine |
| SMILES | C=C(C)N.Cc1cc(N(C)C)ccc1N.Nc1cc(OCCO)c(N)cc1OCCO |
| InChI | InChI=1S/C10H16N2O4.C9H14N2.C3H7N/c11-7-6-10(16-4-2-14)8(12)5-9(7)15-3-1-13;1-7-6-8(11(2)3)4-5-9(7)10;1-3(2)4/h5-6,13-14H,1-4,11-12H2;4-6H,10H2,1-3H3;1,4H2,2H3 |
| InChIKey | MVDYYXHGFRZTCB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 166.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|