C24H28N2O2S — CID 171529118
(4Z)-4-[amino-(1-methoxy-2-methylpropan-2-yl)-λ4-sulfanylidene]-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)butan-1-one (PubChem CID 171529118) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is (4Z)-4-[amino-(1-methoxy-2-methylpropan-2-yl)-λ4-sulfanylidene]-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)butan-1-one.
| Compound Name | (4Z)-4-[amino-(1-methoxy-2-methylpropan-2-yl)-λ4-sulfanylidene]-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)butan-1-one |
|---|---|
| PubChem CID | 171529118 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (4Z)-4-[amino-(1-methoxy-2-methylpropan-2-yl)-λ4-sulfanylidene]-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)butan-1-one |
| SMILES | COCC(C)(C)/S(N)=C/CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C24H28N2O2S/c1-24(2,18-28-3)29(25)16-8-13-23(27)26-17-21-11-5-4-9-19(21)14-15-20-10-6-7-12-22(20)26/h4-7,9-12,16H,8,13,17-18,25H2,1-3H3 |
| InChIKey | WAWOUOXYIVTWPT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|