C34H43N3O2 — CID 171538675
ethane-1,1-diol;3-[(3S,10R,13S)-3-imidazol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-1-benzazepine (PubChem CID 171538675) has the molecular formula C34H43N3O2 and a molecular weight of 525.74 g/mol. Its IUPAC name is ethane-1,1-diol;3-[(3S,10R,13S)-3-imidazol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-1-benzazepine.
| Compound Name | ethane-1,1-diol;3-[(3S,10R,13S)-3-imidazol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-1-benzazepine |
|---|---|
| PubChem CID | 171538675 |
| Molecular Formula | C34H43N3O2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | ethane-1,1-diol;3-[(3S,10R,13S)-3-imidazol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-1-benzazepine |
| SMILES | CC(O)O.C[C@]12CC[C@H](n3ccnc3)CC1=CCC1C2CC[C@]2(C)C(C3=CCc4ccccc4N=C3)=CCC12 |
| InChI | InChI=1S/C32H37N3.C2H6O2/c1-31-15-13-25(35-18-17-33-21-35)19-24(31)9-10-26-28-12-11-27(32(28,2)16-14-29(26)31)23-8-7-22-5-3-4-6-30(22)34-20-23;1-2(3)4/h3-6,8-9,11,17-18,20-21,25-26,28-29H,7,10,12-16,19H2,1-2H3;2-4H,1H3/t25-,26?,28?,29?,31-,32+;/m0./s1 |
| InChIKey | YBBTZQYALZTBAI-MAROKKIASA-N |
| XLogP | 7.13 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|