C22H40N6O4 — CID 171538918
4-amino-N'-[3-[bis(8-oxooctyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 171538918) has the molecular formula C22H40N6O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-amino-N'-[3-[bis(8-oxooctyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[3-[bis(8-oxooctyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 171538918 |
| Molecular Formula | C22H40N6O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 4-amino-N'-[3-[bis(8-oxooctyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Nc1nonc1/C(=N/CCCN(CCCCCCCC=O)CCCCCCCC=O)NO |
| InChI | InChI=1S/C22H40N6O4/c23-21-20(26-32-27-21)22(25-31)24-14-13-17-28(15-9-5-1-3-7-11-18-29)16-10-6-2-4-8-12-19-30/h18-19,31H,1-17H2,(H2,23,27)(H,24,25) |
| InChIKey | LBBALWCEHIURKY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|