C53H106N5NbO5- — CID 171538961
[1-azanidylidene-3-[3-[bis(8-oxooctyl)amino]propylimino]-3-(hydroxyamino)-1-(methylamino)propan-2-ylidene]niobium;9-methoxyheptadecane;3-methoxyundecane (PubChem CID 171538961) has the molecular formula C53H106N5NbO5- and a molecular weight of 986.37 g/mol. Its IUPAC name is [1-azanidylidene-3-[3-[bis(8-oxooctyl)amino]propylimino]-3-(hydroxyamino)-1-(methylamino)propan-2-ylidene]niobium;9-methoxyheptadecane;3-methoxyundecane.
| Compound Name | [1-azanidylidene-3-[3-[bis(8-oxooctyl)amino]propylimino]-3-(hydroxyamino)-1-(methylamino)propan-2-ylidene]niobium;9-methoxyheptadecane;3-methoxyundecane |
|---|---|
| PubChem CID | 171538961 |
| Molecular Formula | C53H106N5NbO5- |
| Molecular Weight | 986.37 g/mol |
| Exact Mass | 985.73 |
| IUPAC Name | [1-azanidylidene-3-[3-[bis(8-oxooctyl)amino]propylimino]-3-(hydroxyamino)-1-(methylamino)propan-2-ylidene]niobium;9-methoxyheptadecane;3-methoxyundecane |
| SMILES | CCCCCCCCC(CC)OC.CCCCCCCCC(CCCCCCCC)OC.CNC(=[N-])C(=[Nb])/C(=N/CCCN(CCCCCCCC=O)CCCCCCCC=O)NO |
| InChI | InChI=1S/C23H42N5O3.C18H38O.C12H26O.Nb/c1-25-22(24)21-23(27-31)26-15-14-18-28(16-10-6-2-4-8-12-19-29)17-11-7-3-5-9-13-20-30;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2;1-4-6-7-8-9-10-11-12(5-2)13-3;/h19-20H,2-18H2,1H3,(H3-,24,25,26,27,31);18H,4-17H2,1-3H3;12H,4-11H2,1-3H3;/q-1;;; |
| InChIKey | DZXSHLBEGUUBSX-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.37 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|