C40H79N5O3 — CID 176570990
pentadecan-8-yl 8-[3-[(1-hydrazinyl-2-imino-3-methylpentylidene)amino]propyl-(8-oxooctyl)amino]octanoate (PubChem CID 176570990) has the molecular formula C40H79N5O3 and a molecular weight of 678.10 g/mol. Its IUPAC name is pentadecan-8-yl 8-[3-[(1-hydrazinyl-2-imino-3-methylpentylidene)amino]propyl-(8-oxooctyl)amino]octanoate.
| Compound Name | pentadecan-8-yl 8-[3-[(1-hydrazinyl-2-imino-3-methylpentylidene)amino]propyl-(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 176570990 |
| Molecular Formula | C40H79N5O3 |
| Molecular Weight | 678.10 g/mol |
| Exact Mass | 677.62 |
| IUPAC Name | pentadecan-8-yl 8-[3-[(1-hydrazinyl-2-imino-3-methylpentylidene)amino]propyl-(8-oxooctyl)amino]octanoate |
| SMILES | [H]/N=C(C(=N/CCCN(CCCCCCCC=O)CCCCCCCC(=O)OC(CCCCCCC)CCCCCCC)/NN)\C(C)CC |
| InChI | InChI=1S/C40H79N5O3/c1-5-8-10-15-21-28-37(29-22-16-11-9-6-2)48-38(47)30-23-17-14-19-25-33-45(32-24-18-12-13-20-26-35-46)34-27-31-43-40(44-42)39(41)36(4)7-3/h35-37,41H,5-34,42H2,1-4H3,(H,43,44)/b41-39+ |
| InChIKey | URSMRMQVEKGBOI-OHYVAXEESA-N |
| XLogP | 10.12 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.10 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|