C23H41N3O4 — CID 176570858
N-[C-acetyl-N-[3-[bis(8-oxooctyl)amino]propyl]carbonimidoyl]formamide (PubChem CID 176570858) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[C-acetyl-N-[3-[bis(8-oxooctyl)amino]propyl]carbonimidoyl]formamide.
| Compound Name | N-[C-acetyl-N-[3-[bis(8-oxooctyl)amino]propyl]carbonimidoyl]formamide |
|---|---|
| PubChem CID | 176570858 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | N-[C-acetyl-N-[3-[bis(8-oxooctyl)amino]propyl]carbonimidoyl]formamide |
| SMILES | CC(=O)/C(=N\CCCN(CCCCCCCC=O)CCCCCCCC=O)NC=O |
| InChI | InChI=1S/C23H41N3O4/c1-22(30)23(25-21-29)24-15-14-18-26(16-10-6-2-4-8-12-19-27)17-11-7-3-5-9-13-20-28/h19-21H,2-18H2,1H3,(H,24,25,29) |
| InChIKey | SQOOWHKUCFADIA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|