About 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate
2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate (PubChem CID 167224279) has the molecular formula C36H71N3O4
and a molecular weight of 609.98 g/mol. Its IUPAC name is 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate.
Molecular Properties
| Compound Name | 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate |
| PubChem CID | 167224279 |
| Molecular Formula | C36H71N3O4 |
| Molecular Weight | 609.98 g/mol |
| Exact Mass | 609.54 |
| IUPAC Name | 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate |
| SMILES | CCCCCCN(CCCCCC)CCOC(=O)CCCCCCCCCN(CCCCCCCCCC=O)CCN=O |
| InChI | InChI=1S/C36H71N3O4/c1-3-5-7-21-30-39(31-22-8-6-4-2)33-35-43-36(41)26-20-16-12-11-14-18-24-29-38(32-27-37-42)28-23-17-13-9-10-15-19-25-34-40/h34H,3-33,35H2,1-2H3 |
| InChIKey | BXXFSZCQOAYDIS-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.98 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate?
The IUPAC name of 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate (CID 167224279) is 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate.
What is the SMILES notation for 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate?
The canonical SMILES for 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate is CCCCCCN(CCCCCC)CCOC(=O)CCCCCCCCCN(CCCCCCCCCC=O)CCN=O.
What is the InChIKey of 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate?
The InChIKey is BXXFSZCQOAYDIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H71N3O4/c1-3-5-7-21-30-39(31-22-8-6-4-2)33-35-43-36(41)26-20-16-12-11-14-18-24-29-38(32-27-37-42)28-23-17-13-9-10-15-19-25-34-40/h34H,3-33,35H2,1-2H3.
What are the key properties of 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate?
2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate has a molecular weight of 609.98 g/mol, XLogP of 9.50, 36 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dihexylamino)ethyl 10-[2-nitrosoethyl(10-oxodecyl)amino]decanoate is sourced from PubChem (CID 167224279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).