C19H24F2N4O4 — CID 171540921
azetidin-3-yl N-[1-[3,5-difluoro-4-[5-(methylamino)-1,5-dioxopentan-2-yl]phenyl]azetidin-3-yl]carbamate (PubChem CID 171540921) has the molecular formula C19H24F2N4O4 and a molecular weight of 410.42 g/mol. Its IUPAC name is azetidin-3-yl N-[1-[3,5-difluoro-4-[5-(methylamino)-1,5-dioxopentan-2-yl]phenyl]azetidin-3-yl]carbamate.
| Compound Name | azetidin-3-yl N-[1-[3,5-difluoro-4-[5-(methylamino)-1,5-dioxopentan-2-yl]phenyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171540921 |
| Molecular Formula | C19H24F2N4O4 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | azetidin-3-yl N-[1-[3,5-difluoro-4-[5-(methylamino)-1,5-dioxopentan-2-yl]phenyl]azetidin-3-yl]carbamate |
| SMILES | CNC(=O)CCC(C=O)c1c(F)cc(N2CC(NC(=O)OC3CNC3)C2)cc1F |
| InChI | InChI=1S/C19H24F2N4O4/c1-22-17(27)3-2-11(10-26)18-15(20)4-13(5-16(18)21)25-8-12(9-25)24-19(28)29-14-6-23-7-14/h4-5,10-12,14,23H,2-3,6-9H2,1H3,(H,22,27)(H,24,28) |
| InChIKey | KFQUMRRWLSKVMW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|