C20H21F2N3O3 — CID 177027932
2-[2,6-difluoro-4-[4-(4-formylpyrazol-1-yl)piperidin-1-yl]phenyl]pentanedial (PubChem CID 177027932) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[4-(4-formylpyrazol-1-yl)piperidin-1-yl]phenyl]pentanedial.
| Compound Name | 2-[2,6-difluoro-4-[4-(4-formylpyrazol-1-yl)piperidin-1-yl]phenyl]pentanedial |
|---|---|
| PubChem CID | 177027932 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[2,6-difluoro-4-[4-(4-formylpyrazol-1-yl)piperidin-1-yl]phenyl]pentanedial |
| SMILES | O=CCCC(C=O)c1c(F)cc(N2CCC(n3cc(C=O)cn3)CC2)cc1F |
| InChI | InChI=1S/C20H21F2N3O3/c21-18-8-17(9-19(22)20(18)15(13-28)2-1-7-26)24-5-3-16(4-6-24)25-11-14(12-27)10-23-25/h7-13,15-16H,1-6H2 |
| InChIKey | MUFJEZDNNHTQMO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|