C23H23N5OSSi — CID 171541986
(15R)-15-methyl-5-[2-(2-trimethylsilylethynyl)imidazol-1-yl]-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 171541986) has the molecular formula C23H23N5OSSi and a molecular weight of 445.62 g/mol. Its IUPAC name is (15R)-15-methyl-5-[2-(2-trimethylsilylethynyl)imidazol-1-yl]-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-15-methyl-5-[2-(2-trimethylsilylethynyl)imidazol-1-yl]-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 171541986 |
| Molecular Formula | C23H23N5OSSi |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (15R)-15-methyl-5-[2-(2-trimethylsilylethynyl)imidazol-1-yl]-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C[C@@H]1CNc2c(sc3ccc4nc(-n5ccnc5C#C[Si](C)(C)C)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C23H23N5OSSi/c1-14-13-25-21-20-15-5-8-19(28-11-10-24-18(28)9-12-31(2,3)4)27-16(15)6-7-17(20)30-22(21)23(29)26-14/h5-8,10-11,14,25H,13H2,1-4H3,(H,26,29)/t14-/m1/s1 |
| InChIKey | HMZPUKLCOVNBEV-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|