C33H25F5N4O6S — CID 171549270
(2,3,4,5,6-pentafluorophenyl) 3-[(1R)-1-[3,6-dimethyl-2-(2-methylpyrazolo[4,3-b]pyridin-5-yl)-4-oxochromen-8-yl]ethoxy]-6-ethylpyridine-2-sulfonate (PubChem CID 171549270) has the molecular formula C33H25F5N4O6S and a molecular weight of 700.64 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[(1R)-1-[3,6-dimethyl-2-(2-methylpyrazolo[4,3-b]pyridin-5-yl)-4-oxochromen-8-yl]ethoxy]-6-ethylpyridine-2-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[(1R)-1-[3,6-dimethyl-2-(2-methylpyrazolo[4,3-b]pyridin-5-yl)-4-oxochromen-8-yl]ethoxy]-6-ethylpyridine-2-sulfonate |
|---|---|
| PubChem CID | 171549270 |
| Molecular Formula | C33H25F5N4O6S |
| Molecular Weight | 700.64 g/mol |
| Exact Mass | 700.14 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[(1R)-1-[3,6-dimethyl-2-(2-methylpyrazolo[4,3-b]pyridin-5-yl)-4-oxochromen-8-yl]ethoxy]-6-ethylpyridine-2-sulfonate |
| SMILES | CCc1ccc(O[C@H](C)c2cc(C)cc3c(=O)c(C)c(-c4ccc5nn(C)cc5n4)oc23)c(S(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C33H25F5N4O6S/c1-6-17-7-10-23(33(39-17)49(44,45)48-32-27(37)25(35)24(34)26(36)28(32)38)46-16(4)18-11-14(2)12-19-29(43)15(3)30(47-31(18)19)21-9-8-20-22(40-21)13-42(5)41-20/h7-13,16H,6H2,1-5H3/t16-/m1/s1 |
| InChIKey | HQBLSNDJPOJUDM-MRXNPFEDSA-N |
| XLogP | 6.92 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.64 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|