C11H15N3O5 — CID 171556675
methyl 5-[(3,4-dihydroxyoxan-2-yl)amino]pyrazine-2-carboxylate (PubChem CID 171556675) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 5-[(3,4-dihydroxyoxan-2-yl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[(3,4-dihydroxyoxan-2-yl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 171556675 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | methyl 5-[(3,4-dihydroxyoxan-2-yl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(NC2OCCC(O)C2O)cn1 |
| InChI | InChI=1S/C11H15N3O5/c1-18-11(17)6-4-13-8(5-12-6)14-10-9(16)7(15)2-3-19-10/h4-5,7,9-10,15-16H,2-3H2,1H3,(H,13,14) |
| InChIKey | ASXWIFALUZCISJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |