C20H24F3NO3S — CID 171556731
2-[[(6aR,7R,8R,10R,10aR)-8-ethynyl-2,2,10-trimethyl-4,5,6,6a,7,8,10,10a-octahydropyrano[4,3-g][1,3]oxathiocin-7-yl]oxy]-6-(trifluoromethyl)pyridine (PubChem CID 171556731) has the molecular formula C20H24F3NO3S and a molecular weight of 415.48 g/mol. Its IUPAC name is 2-[[(6aR,7R,8R,10R,10aR)-8-ethynyl-2,2,10-trimethyl-4,5,6,6a,7,8,10,10a-octahydropyrano[4,3-g][1,3]oxathiocin-7-yl]oxy]-6-(trifluoromethyl)pyridine.
| Compound Name | 2-[[(6aR,7R,8R,10R,10aR)-8-ethynyl-2,2,10-trimethyl-4,5,6,6a,7,8,10,10a-octahydropyrano[4,3-g][1,3]oxathiocin-7-yl]oxy]-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 171556731 |
| Molecular Formula | C20H24F3NO3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[[(6aR,7R,8R,10R,10aR)-8-ethynyl-2,2,10-trimethyl-4,5,6,6a,7,8,10,10a-octahydropyrano[4,3-g][1,3]oxathiocin-7-yl]oxy]-6-(trifluoromethyl)pyridine |
| SMILES | C#C[C@H]1O[C@H](C)[C@@H]2OC(C)(C)SCCC[C@@H]2[C@H]1Oc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H24F3NO3S/c1-5-14-18(26-16-10-6-9-15(24-16)20(21,22)23)13-8-7-11-28-19(3,4)27-17(13)12(2)25-14/h1,6,9-10,12-14,17-18H,7-8,11H2,2-4H3/t12-,13+,14-,17+,18-/m1/s1 |
| InChIKey | NTHPECIIKIVFMH-NFBPQSOOSA-N |
| XLogP | 4.53 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|