C25H37F3N6O6 — CID 171556814
methyl 2-[4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]piperidin-1-yl]piperidin-1-yl]acetate (PubChem CID 171556814) has the molecular formula C25H37F3N6O6 and a molecular weight of 574.60 g/mol. Its IUPAC name is methyl 2-[4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]piperidin-1-yl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]piperidin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 171556814 |
| Molecular Formula | C25H37F3N6O6 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | methyl 2-[4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]piperidin-1-yl]piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCC(N2CCC(C(=O)NC[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)CC2)CC1 |
| InChI | InChI=1S/C25H37F3N6O6/c1-39-21(35)13-33-6-4-16(5-7-33)34-8-2-15(3-9-34)24(38)30-10-18-23(37)22(36)17(14-40-18)31-20-12-29-11-19(32-20)25(26,27)28/h11-12,15-18,22-23,36-37H,2-10,13-14H2,1H3,(H,30,38)(H,31,32)/t17-,18+,22+,23-/m0/s1 |
| InChIKey | JLUKSRZOAXDQSA-RBHHUKDOSA-N |
| XLogP | -0.14 |
| TPSA | 149.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |