C14H17F3N4O3 — CID 171557085
[(3aS,4R,7aR)-2,2-dimethyl-7-[6-(trifluoromethyl)pyrazin-2-yl]imino-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine (PubChem CID 171557085) has the molecular formula C14H17F3N4O3 and a molecular weight of 346.31 g/mol. Its IUPAC name is [(3aS,4R,7aR)-2,2-dimethyl-7-[6-(trifluoromethyl)pyrazin-2-yl]imino-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine.
| Compound Name | [(3aS,4R,7aR)-2,2-dimethyl-7-[6-(trifluoromethyl)pyrazin-2-yl]imino-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine |
|---|---|
| PubChem CID | 171557085 |
| Molecular Formula | C14H17F3N4O3 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(3aS,4R,7aR)-2,2-dimethyl-7-[6-(trifluoromethyl)pyrazin-2-yl]imino-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)/C(=N/c1cncc(C(F)(F)F)n1)CO[C@@H]2CN |
| InChI | InChI=1S/C14H17F3N4O3/c1-13(2)23-11-7(6-22-8(3-18)12(11)24-13)20-10-5-19-4-9(21-10)14(15,16)17/h4-5,8,11-12H,3,6,18H2,1-2H3/b20-7+/t8-,11-,12+/m1/s1 |
| InChIKey | UJKFAFCROAORRW-HUDUODJESA-N |
| XLogP | 1.45 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|