C26H40F3N5O5 — CID 171557446
tert-butyl 4-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]ethyl]piperidine-1-carboxylate (PubChem CID 171557446) has the molecular formula C26H40F3N5O5 and a molecular weight of 559.63 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171557446 |
| Molecular Formula | C26H40F3N5O5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | tert-butyl 4-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCNC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@H]3OC(C)(C)O[C@H]32)CC1 |
| InChI | InChI=1S/C26H40F3N5O5/c1-24(2,3)39-23(35)34-10-7-16(8-11-34)6-9-30-12-18-22-21(37-25(4,5)38-22)17(15-36-18)32-20-14-31-13-19(33-20)26(27,28)29/h13-14,16-18,21-22,30H,6-12,15H2,1-5H3,(H,32,33)/t17-,18+,21+,22-/m0/s1 |
| InChIKey | ABZRJVHRRRGCSJ-KKXYHZGYSA-N |
| XLogP | 3.82 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|