C15H19F3N4O3 — CID 171557840
[(3aR,4R,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine (PubChem CID 171557840) has the molecular formula C15H19F3N4O3 and a molecular weight of 360.34 g/mol. Its IUPAC name is [(3aR,4R,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine.
| Compound Name | [(3aR,4R,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine |
|---|---|
| PubChem CID | 171557840 |
| Molecular Formula | C15H19F3N4O3 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [(3aR,4R,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methanamine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(/C=N/c1cncc(C(F)(F)F)n1)CO[C@@H]2CN |
| InChI | InChI=1S/C15H19F3N4O3/c1-14(2)24-12-8(7-23-9(3-19)13(12)25-14)4-21-11-6-20-5-10(22-11)15(16,17)18/h4-6,8-9,12-13H,3,7,19H2,1-2H3/b21-4+/t8?,9-,12-,13+/m1/s1 |
| InChIKey | YRFPBWMEQVLCPO-DJTHJHMVSA-N |
| XLogP | 1.69 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|