C22H29F3N6O5 — CID 171557876
N-[(3aR,4R,7S,7aR)-2,2-dimethyl-4-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557876) has the molecular formula C22H29F3N6O5 and a molecular weight of 514.51 g/mol. Its IUPAC name is N-[(3aR,4R,7S,7aR)-2,2-dimethyl-4-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(3aR,4R,7S,7aR)-2,2-dimethyl-4-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557876 |
| Molecular Formula | C22H29F3N6O5 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-[(3aR,4R,7S,7aR)-2,2-dimethyl-4-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2COCCOCCNc1cnccn1 |
| InChI | InChI=1S/C22H29F3N6O5/c1-21(2)35-19-14(30-18-11-27-9-16(31-18)22(23,24)25)12-34-15(20(19)36-21)13-33-8-7-32-6-5-29-17-10-26-3-4-28-17/h3-4,9-11,14-15,19-20H,5-8,12-13H2,1-2H3,(H,28,29)(H,30,31)/t14-,15+,19+,20-/m0/s1 |
| InChIKey | MTPORGPAVMHHPJ-BWMZKYQQSA-N |
| XLogP | 2.13 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|