C22H32F3N5O6 — CID 171558093
methyl 6-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylcarbamoylamino]hexanoate (PubChem CID 171558093) has the molecular formula C22H32F3N5O6 and a molecular weight of 519.52 g/mol. Its IUPAC name is methyl 6-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylcarbamoylamino]hexanoate.
| Compound Name | methyl 6-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylcarbamoylamino]hexanoate |
|---|---|
| PubChem CID | 171558093 |
| Molecular Formula | C22H32F3N5O6 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | methyl 6-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylcarbamoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H32F3N5O6/c1-21(2)35-18-13(29-16-11-26-10-15(30-16)22(23,24)25)12-34-14(19(18)36-21)9-28-20(32)27-8-6-4-5-7-17(31)33-3/h10-11,13-14,18-19H,4-9,12H2,1-3H3,(H,29,30)(H2,27,28,32)/t13-,14+,18+,19-/m0/s1 |
| InChIKey | YMEKHFWOXFDBEZ-RAKLQZGLSA-N |
| XLogP | 2.23 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|