C29H55NO6S — CID 171558155
2-acetyl-N-[1,3-bis(4-methyl-3-oxopentoxy)propan-2-yl]-4-ethylsulfanyl-N,2,4-trimethylpentanamide;ethane (PubChem CID 171558155) has the molecular formula C29H55NO6S and a molecular weight of 545.83 g/mol. Its IUPAC name is 2-acetyl-N-[1,3-bis(4-methyl-3-oxopentoxy)propan-2-yl]-4-ethylsulfanyl-N,2,4-trimethylpentanamide;ethane.
| Compound Name | 2-acetyl-N-[1,3-bis(4-methyl-3-oxopentoxy)propan-2-yl]-4-ethylsulfanyl-N,2,4-trimethylpentanamide;ethane |
|---|---|
| PubChem CID | 171558155 |
| Molecular Formula | C29H55NO6S |
| Molecular Weight | 545.83 g/mol |
| Exact Mass | 545.38 |
| IUPAC Name | 2-acetyl-N-[1,3-bis(4-methyl-3-oxopentoxy)propan-2-yl]-4-ethylsulfanyl-N,2,4-trimethylpentanamide;ethane |
| SMILES | CC.CCSC(C)(C)CC(C)(C(C)=O)C(=O)N(C)C(COCCC(=O)C(C)C)COCCC(=O)C(C)C |
| InChI | InChI=1S/C27H49NO6S.C2H6/c1-11-35-26(7,8)18-27(9,21(6)29)25(32)28(10)22(16-33-14-12-23(30)19(2)3)17-34-15-13-24(31)20(4)5;1-2/h19-20,22H,11-18H2,1-10H3;1-2H3 |
| InChIKey | ZXDCRLMPWBYAKK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|