C14H19F4N3O4 — CID 171558232
(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanol;N-fluoro-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171558232) has the molecular formula C14H19F4N3O4 and a molecular weight of 369.32 g/mol. Its IUPAC name is (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanol;N-fluoro-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanol;N-fluoro-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171558232 |
| Molecular Formula | C14H19F4N3O4 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanol;N-fluoro-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)OC2CCOC(CO)C2O1.FNc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H16O4.C5H3F4N3/c1-9(2)12-6-3-4-11-7(5-10)8(6)13-9;6-5(7,8)3-1-10-2-4(11-3)12-9/h6-8,10H,3-5H2,1-2H3;1-2H,(H,11,12) |
| InChIKey | AJOMRBNOKATYDX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|