C16H25F3IN3O4S — CID 171558131
(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;ethane;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171558131) has the molecular formula C16H25F3IN3O4S and a molecular weight of 539.36 g/mol. Its IUPAC name is (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;ethane;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;ethane;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171558131 |
| Molecular Formula | C16H25F3IN3O4S |
| Molecular Weight | 539.36 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy thiohypoiodite;ethane;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC.CC1(C)OC2CCOC(COSI)C2O1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H15IO4S.C5H4F3N3.C2H6/c1-9(2)13-6-3-4-11-7(5-12-15-10)8(6)14-9;6-5(7,8)3-1-10-2-4(9)11-3;1-2/h6-8H,3-5H2,1-2H3;1-2H,(H2,9,11);1-2H3 |
| InChIKey | ZNBGNXPPTSQWNQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|