C22H25Cl2NO — CID 17156647
N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]-1-phenylbutan-1-amine;hydrochloride (PubChem CID 17156647) has the molecular formula C22H25Cl2NO and a molecular weight of 390.35 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]-1-phenylbutan-1-amine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]-1-phenylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156647 |
| Molecular Formula | C22H25Cl2NO |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | N-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methyl]-1-phenylbutan-1-amine;hydrochloride |
| SMILES | CCCC(NCc1ccc(-c2ccc(C)c(Cl)c2)o1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H24ClNO.ClH/c1-3-7-21(17-8-5-4-6-9-17)24-15-19-12-13-22(25-19)18-11-10-16(2)20(23)14-18;/h4-6,8-14,21,24H,3,7,15H2,1-2H3;1H |
| InChIKey | ZBIWUOXGWODEKR-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |