C19H27NO3 — CID 171567537
(3aR,6aS)-3a-(3,4-dimethoxyphenyl)-4-ethyl-1-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-6-carbaldehyde (PubChem CID 171567537) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3aR,6aS)-3a-(3,4-dimethoxyphenyl)-4-ethyl-1-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-6-carbaldehyde.
| Compound Name | (3aR,6aS)-3a-(3,4-dimethoxyphenyl)-4-ethyl-1-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-6-carbaldehyde |
|---|---|
| PubChem CID | 171567537 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3aR,6aS)-3a-(3,4-dimethoxyphenyl)-4-ethyl-1-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-6-carbaldehyde |
| SMILES | CCC1CC(C=O)[C@@H]2N(C)CC[C@]12c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H27NO3/c1-5-14-10-13(12-21)18-19(14,8-9-20(18)2)15-6-7-16(22-3)17(11-15)23-4/h6-7,11-14,18H,5,8-10H2,1-4H3/t13?,14?,18-,19+/m0/s1 |
| InChIKey | ADAKKYCPAMOOFS-BDHCGPDFSA-N |
| XLogP | 2.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|